C26H20N4O6S — CID 2375511
2-[(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 2375511) has the molecular formula C26H20N4O6S and a molecular weight of 516.54 g/mol. Its IUPAC name is 2-[(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2375511 |
| Molecular Formula | C26H20N4O6S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-[(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc4c(c3)OCO4)N=C2SCC(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H20N4O6S/c1-16-5-8-19(9-6-16)29-25(32)21(11-17-7-10-22-23(12-17)36-15-35-22)28-26(29)37-14-24(31)27-18-3-2-4-20(13-18)30(33)34/h2-13H,14-15H2,1H3,(H,27,31)/b21-11- |
| InChIKey | RCMKUVCJPMOETH-NHDPSOOVSA-N |
| XLogP | 4.75 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|