C25H20N2O3S — CID 16504255
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-benzylsulfanyl-3-(4-methylphenyl)imidazol-4-one (PubChem CID 16504255) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-benzylsulfanyl-3-(4-methylphenyl)imidazol-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-benzylsulfanyl-3-(4-methylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 16504255 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-benzylsulfanyl-3-(4-methylphenyl)imidazol-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc4c(c3)OCO4)N=C2SCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O3S/c1-17-7-10-20(11-8-17)27-24(28)21(13-19-9-12-22-23(14-19)30-16-29-22)26-25(27)31-15-18-5-3-2-4-6-18/h2-14H,15-16H2,1H3/b21-13+ |
| InChIKey | DXCQNIIJLJPAHO-FYJGNVAPSA-N |
| XLogP | 5.40 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|