C26H21N3O4S — CID 46689245
2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-2-phenylacetamide (PubChem CID 46689245) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-2-phenylacetamide.
| Compound Name | 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 46689245 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-2-phenylacetamide |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc4c(c3)OCO4)N=C2SC(C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O4S/c1-16-7-10-19(11-8-16)29-25(31)20(13-17-9-12-21-22(14-17)33-15-32-21)28-26(29)34-23(24(27)30)18-5-3-2-4-6-18/h2-14,23H,15H2,1H3,(H2,27,30)/b20-13+ |
| InChIKey | KEQVZEJBNKBYOL-DEDYPNTBSA-N |
| XLogP | 4.43 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|