C24H16F4N2OS — CID 3921890
5-benzylidene-3-(4-fluorophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-one (PubChem CID 3921890) has the molecular formula C24H16F4N2OS and a molecular weight of 456.46 g/mol. Its IUPAC name is 5-benzylidene-3-(4-fluorophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-one.
| Compound Name | 5-benzylidene-3-(4-fluorophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-one |
|---|---|
| PubChem CID | 3921890 |
| Molecular Formula | C24H16F4N2OS |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 5-benzylidene-3-(4-fluorophenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-one |
| SMILES | O=C1C(=Cc2ccccc2)N=C(SCc2cccc(C(F)(F)F)c2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H16F4N2OS/c25-19-9-11-20(12-10-19)30-22(31)21(14-16-5-2-1-3-6-16)29-23(30)32-15-17-7-4-8-18(13-17)24(26,27)28/h1-14H,15H2 |
| InChIKey | FXRDWBDPVLUQLI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|