C23H21FN4O2S — CID 24651631
(5Z)-5-benzylidene-2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(4-fluorophenyl)imidazol-4-one (PubChem CID 24651631) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(4-fluorophenyl)imidazol-4-one.
| Compound Name | (5Z)-5-benzylidene-2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(4-fluorophenyl)imidazol-4-one |
|---|---|
| PubChem CID | 24651631 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (5Z)-5-benzylidene-2-[(3-butyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-3-(4-fluorophenyl)imidazol-4-one |
| SMILES | CCCCc1noc(CSC2=N/C(=C\c3ccccc3)C(=O)N2c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C23H21FN4O2S/c1-2-3-9-20-26-21(30-27-20)15-31-23-25-19(14-16-7-5-4-6-8-16)22(29)28(23)18-12-10-17(24)11-13-18/h4-8,10-14H,2-3,9,15H2,1H3/b19-14- |
| InChIKey | STXKTMMNSXEXMO-RGEXLXHISA-N |
| XLogP | 5.23 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|