C26H23FN2O4S — CID 3961445
2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 3961445) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 3961445 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(C=C2N=C(SCCOc3ccccc3F)N(c3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H23FN2O4S/c1-31-20-12-10-18(11-13-20)16-23-25(30)29(19-6-5-7-21(17-19)32-2)26(28-23)34-15-14-33-24-9-4-3-8-22(24)27/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | XFBXDIZHMRYTOE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|