C27H25BrN2O3S — CID 2417199
(5E)-2-[2-(4-bromophenoxy)ethylsulfanyl]-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 2417199) has the molecular formula C27H25BrN2O3S and a molecular weight of 537.48 g/mol. Its IUPAC name is (5E)-2-[2-(4-bromophenoxy)ethylsulfanyl]-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | (5E)-2-[2-(4-bromophenoxy)ethylsulfanyl]-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 2417199 |
| Molecular Formula | C27H25BrN2O3S |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | (5E)-2-[2-(4-bromophenoxy)ethylsulfanyl]-3-(3,5-dimethylphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(/C=C2/N=C(SCCOc3ccc(Br)cc3)N(c3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H25BrN2O3S/c1-18-14-19(2)16-22(15-18)30-26(31)25(17-20-4-8-23(32-3)9-5-20)29-27(30)34-13-12-33-24-10-6-21(28)7-11-24/h4-11,14-17H,12-13H2,1-3H3/b25-17+ |
| InChIKey | KQHARJHKXGSIMN-KOEQRZSOSA-N |
| XLogP | 6.63 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|