C25H20Cl2N2O3S — CID 3592629
2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 3592629) has the molecular formula C25H20Cl2N2O3S and a molecular weight of 499.42 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 3592629 |
| Molecular Formula | C25H20Cl2N2O3S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(C=C2N=C(SCc3c(Cl)cccc3Cl)N(c3cccc(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O3S/c1-31-18-11-9-16(10-12-18)13-23-24(30)29(17-5-3-6-19(14-17)32-2)25(28-23)33-15-20-21(26)7-4-8-22(20)27/h3-14H,15H2,1-2H3 |
| InChIKey | VBHAVYOWYJWGSL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|