C25H21ClN2O3S — CID 16503311
(5Z)-2-benzylsulfanyl-3-(4-chloro-3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one (PubChem CID 16503311) has the molecular formula C25H21ClN2O3S and a molecular weight of 464.97 g/mol. Its IUPAC name is (5Z)-2-benzylsulfanyl-3-(4-chloro-3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-2-benzylsulfanyl-3-(4-chloro-3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 16503311 |
| Molecular Formula | C25H21ClN2O3S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (5Z)-2-benzylsulfanyl-3-(4-chloro-3-methoxyphenyl)-5-[(4-methoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1ccc(/C=C2\N=C(SCc3ccccc3)N(c3ccc(Cl)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H21ClN2O3S/c1-30-20-11-8-17(9-12-20)14-22-24(29)28(19-10-13-21(26)23(15-19)31-2)25(27-22)32-16-18-6-4-3-5-7-18/h3-15H,16H2,1-2H3/b22-14- |
| InChIKey | MQFNOJPFZFYTGA-HMAPJEAMSA-N |
| XLogP | 6.03 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|