C22H21ClN2O5S — CID 4812032
ethyl 2-[1-(4-chloro-3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetate (PubChem CID 4812032) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is ethyl 2-[1-(4-chloro-3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[1-(4-chloro-3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 4812032 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | ethyl 2-[1-(4-chloro-3-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSC1=NC(=Cc2ccc(OC)cc2)C(=O)N1c1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C22H21ClN2O5S/c1-4-30-20(26)13-31-22-24-18(11-14-5-8-16(28-2)9-6-14)21(27)25(22)15-7-10-17(23)19(12-15)29-3/h5-12H,4,13H2,1-3H3 |
| InChIKey | ZXDWJKNRKJXKEL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|