C21H22N2O5S — CID 46246793
(5Z)-3-(3-methoxyphenyl)-2-methylsulfanyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-4-one (PubChem CID 46246793) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is (5Z)-3-(3-methoxyphenyl)-2-methylsulfanyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-3-(3-methoxyphenyl)-2-methylsulfanyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 46246793 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (5Z)-3-(3-methoxyphenyl)-2-methylsulfanyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1cccc(N2C(=O)/C(=C/c3cc(OC)c(OC)cc3OC)N=C2SC)c1 |
| InChI | InChI=1S/C21H22N2O5S/c1-25-15-8-6-7-14(11-15)23-20(24)16(22-21(23)29-5)9-13-10-18(27-3)19(28-4)12-17(13)26-2/h6-12H,1-5H3/b16-9- |
| InChIKey | MROALQHVKAGXSD-SXGWCWSVSA-N |
| XLogP | 3.83 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|