C26H20F3N3O3S — CID 91969781
2-[4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 91969781) has the molecular formula C26H20F3N3O3S and a molecular weight of 511.53 g/mol. Its IUPAC name is 2-[4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 91969781 |
| Molecular Formula | C26H20F3N3O3S |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 2-[4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cc1cccc(C=C2N=C(SCC(=O)Nc3ccc(OC(F)(F)F)cc3)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H20F3N3O3S/c1-17-6-5-7-18(14-17)15-22-24(34)32(20-8-3-2-4-9-20)25(31-22)36-16-23(33)30-19-10-12-21(13-11-19)35-26(27,28)29/h2-15H,16H2,1H3,(H,30,33) |
| InChIKey | VIGHWUQNXWWHMT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|