C24H17F3N4O3S — CID 91969805
2-[5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 91969805) has the molecular formula C24H17F3N4O3S and a molecular weight of 498.49 g/mol. Its IUPAC name is 2-[5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 91969805 |
| Molecular Formula | C24H17F3N4O3S |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanyl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CSC1=NC(=Cc2cccnc2)C(=O)N1c1ccccc1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H17F3N4O3S/c25-24(26,27)34-19-10-8-17(9-11-19)29-21(32)15-35-23-30-20(13-16-5-4-12-28-14-16)22(33)31(23)18-6-2-1-3-7-18/h1-14H,15H2,(H,29,32) |
| InChIKey | GKNFQAQZKSXDNC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|