C18H15N3O3S — CID 53270271
3-[(4Z)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylpropanoic acid (PubChem CID 53270271) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[(4Z)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[(4Z)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 53270271 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-[(4Z)-5-oxo-1-phenyl-4-(pyridin-3-ylmethylidene)imidazol-2-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC1=N/C(=C\c2cccnc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H15N3O3S/c22-16(23)8-10-25-18-20-15(11-13-5-4-9-19-12-13)17(24)21(18)14-6-2-1-3-7-14/h1-7,9,11-12H,8,10H2,(H,22,23)/b15-11- |
| InChIKey | FNCDJXKECULZSO-PTNGSMBKSA-N |
| XLogP | 3.03 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|