C17H15N3OS — CID 2726690
3-benzyl-2-methylsulfanyl-5-(pyridin-3-ylmethylidene)imidazol-4-one (PubChem CID 2726690) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-benzyl-2-methylsulfanyl-5-(pyridin-3-ylmethylidene)imidazol-4-one.
| Compound Name | 3-benzyl-2-methylsulfanyl-5-(pyridin-3-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 2726690 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-benzyl-2-methylsulfanyl-5-(pyridin-3-ylmethylidene)imidazol-4-one |
| SMILES | CSC1=NC(=Cc2cccnc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H15N3OS/c1-22-17-19-15(10-14-8-5-9-18-11-14)16(21)20(17)12-13-6-3-2-4-7-13/h2-11H,12H2,1H3 |
| InChIKey | MWFXTHSDPFAFRN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|