C18H14Cl2N2OS — CID 2726724
3-[(4-chlorophenyl)methyl]-5-[(4-chlorophenyl)methylidene]-2-methylsulfanylimidazol-4-one (PubChem CID 2726724) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5-[(4-chlorophenyl)methylidene]-2-methylsulfanylimidazol-4-one.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5-[(4-chlorophenyl)methylidene]-2-methylsulfanylimidazol-4-one |
|---|---|
| PubChem CID | 2726724 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5-[(4-chlorophenyl)methylidene]-2-methylsulfanylimidazol-4-one |
| SMILES | CSC1=NC(=Cc2ccc(Cl)cc2)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-24-18-21-16(10-12-2-6-14(19)7-3-12)17(23)22(18)11-13-4-8-15(20)9-5-13/h2-10H,11H2,1H3 |
| InChIKey | ICBBAWYEDQWVDJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|