C12H8ClN2O3Se — CID 6435390
4-((4-Chlorophenyl)methylene)-5-oxo-2-selenoxo-1-imidazolidineacetic acid (PubChem CID 6435390) has the molecular formula C12H8ClN2O3Se and a molecular weight of 342.62 g/mol.
| Compound Name | 4-((4-Chlorophenyl)methylene)-5-oxo-2-selenoxo-1-imidazolidineacetic acid |
|---|---|
| PubChem CID | 6435390 |
| Molecular Formula | C12H8ClN2O3Se |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | — |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2ccc(Cl)cc2)N=C1[Se] |
| InChI | InChI=1S/C12H8ClN2O3Se/c13-8-3-1-7(2-4-8)5-9-11(18)15(6-10(16)17)12(19)14-9/h1-5H,6H2,(H,16,17)/b9-5- |
| InChIKey | OFVMDPDPIQQGJF-UITAMQMPSA-N |
| XLogP | 1.13 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|