C18H14ClNO4 — CID 28863751
2-[(2E)-2-[(4-chlorophenyl)methylidene]-6-methyl-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 28863751) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-chlorophenyl)methylidene]-6-methyl-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]-6-methyl-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 28863751 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]-6-methyl-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)N(CC(=O)O)C(=O)/C(=C\c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C18H14ClNO4/c1-11-2-7-15-14(8-11)20(10-17(21)22)18(23)16(24-15)9-12-3-5-13(19)6-4-12/h2-9H,10H2,1H3,(H,21,22)/b16-9+ |
| InChIKey | JICXQBHQRNVZPD-CXUHLZMHSA-N |
| XLogP | 3.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|