C17H15ClN4O3 — CID 28863785
2-[(2E)-7-amino-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide (PubChem CID 28863785) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 2-[(2E)-7-amino-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide.
| Compound Name | 2-[(2E)-7-amino-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 28863785 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[(2E)-7-amino-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)/C(=C\c2ccc(Cl)cc2)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C17H15ClN4O3/c18-11-3-1-10(2-4-11)7-15-17(24)22(9-16(23)21-20)13-6-5-12(19)8-14(13)25-15/h1-8H,9,19-20H2,(H,21,23)/b15-7+ |
| InChIKey | JSDXVYBLUJAZDZ-VIZOYTHASA-N |
| XLogP | 1.68 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|