C21H22N4O3 — CID 28862773
(2E)-7-amino-4-(2-oxo-2-piperidin-1-ylethyl)-2-(pyridin-4-ylmethylidene)-1,4-benzoxazin-3-one (PubChem CID 28862773) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2E)-7-amino-4-(2-oxo-2-piperidin-1-ylethyl)-2-(pyridin-4-ylmethylidene)-1,4-benzoxazin-3-one.
| Compound Name | (2E)-7-amino-4-(2-oxo-2-piperidin-1-ylethyl)-2-(pyridin-4-ylmethylidene)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28862773 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2E)-7-amino-4-(2-oxo-2-piperidin-1-ylethyl)-2-(pyridin-4-ylmethylidene)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)O/C(=C/c1ccncc1)C(=O)N2CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H22N4O3/c22-16-4-5-17-18(13-16)28-19(12-15-6-8-23-9-7-15)21(27)25(17)14-20(26)24-10-2-1-3-11-24/h4-9,12-13H,1-3,10-11,14,22H2/b19-12+ |
| InChIKey | RXICVIZRDLJYMO-XDHOZWIPSA-N |
| XLogP | 2.44 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|