C21H21N3O4 — CID 28863078
(2E)-6-amino-2-benzylidene-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one (PubChem CID 28863078) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2E)-6-amino-2-benzylidene-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one.
| Compound Name | (2E)-6-amino-2-benzylidene-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28863078 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2E)-6-amino-2-benzylidene-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(CC(=O)N1CCOCC1)C(=O)/C(=C\c1ccccc1)O2 |
| InChI | InChI=1S/C21H21N3O4/c22-16-6-7-18-17(13-16)24(14-20(25)23-8-10-27-11-9-23)21(26)19(28-18)12-15-4-2-1-3-5-15/h1-7,12-13H,8-11,14,22H2/b19-12+ |
| InChIKey | IMXCBVXSWUGJHS-XDHOZWIPSA-N |
| XLogP | 1.89 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|