C19H19N3O3 — CID 28863005
2-[(2E)-7-amino-2-benzylidene-3-oxo-1,4-benzoxazin-4-yl]-N,N-dimethylacetamide (PubChem CID 28863005) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(2E)-7-amino-2-benzylidene-3-oxo-1,4-benzoxazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(2E)-7-amino-2-benzylidene-3-oxo-1,4-benzoxazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 28863005 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[(2E)-7-amino-2-benzylidene-3-oxo-1,4-benzoxazin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)/C(=C\c2ccccc2)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C19H19N3O3/c1-21(2)18(23)12-22-15-9-8-14(20)11-16(15)25-17(19(22)24)10-13-6-4-3-5-7-13/h3-11H,12,20H2,1-2H3/b17-10+ |
| InChIKey | CMPMDLUAXJBDRJ-LICLKQGHSA-N |
| XLogP | 2.12 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|