C27H24FN3O3 — CID 4102185
2-[(4-fluorophenyl)methylidene]-4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzoxazin-3-one (PubChem CID 4102185) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylidene]-4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-[(4-fluorophenyl)methylidene]-4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 4102185 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[(4-fluorophenyl)methylidene]-4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,4-benzoxazin-3-one |
| SMILES | O=C(CN1C(=O)C(=Cc2ccc(F)cc2)Oc2ccccc21)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H24FN3O3/c28-21-12-10-20(11-13-21)18-25-27(33)31(23-8-4-5-9-24(23)34-25)19-26(32)30-16-14-29(15-17-30)22-6-2-1-3-7-22/h1-13,18H,14-17,19H2 |
| InChIKey | LWIIXRGSMVNCNN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|