C29H28ClN3O3 — CID 3500629
2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzoxazin-3-one (PubChem CID 3500629) has the molecular formula C29H28ClN3O3 and a molecular weight of 502.01 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3500629 |
| Molecular Formula | C29H28ClN3O3 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methylidene]-4-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CN3C(=O)C(=Cc4cccc(Cl)c4)Oc4ccccc43)CC2)c1C |
| InChI | InChI=1S/C29H28ClN3O3/c1-20-7-5-11-24(21(20)2)31-13-15-32(16-14-31)28(34)19-33-25-10-3-4-12-26(25)36-27(29(33)35)18-22-8-6-9-23(30)17-22/h3-12,17-18H,13-16,19H2,1-2H3 |
| InChIKey | KRMHRJNQWFXBCY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|