C28H26BrN3O3 — CID 3400945
4-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-[(2-bromophenyl)methylidene]-1,4-benzoxazin-3-one (PubChem CID 3400945) has the molecular formula C28H26BrN3O3 and a molecular weight of 532.44 g/mol. Its IUPAC name is 4-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-[(2-bromophenyl)methylidene]-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-[(2-bromophenyl)methylidene]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3400945 |
| Molecular Formula | C28H26BrN3O3 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 4-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-[(2-bromophenyl)methylidene]-1,4-benzoxazin-3-one |
| SMILES | O=C(CN1C(=O)C(=Cc2ccccc2Br)Oc2ccccc21)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H26BrN3O3/c29-23-11-5-4-10-22(23)18-26-28(34)32(24-12-6-7-13-25(24)35-26)20-27(33)31-16-14-30(15-17-31)19-21-8-2-1-3-9-21/h1-13,18H,14-17,19-20H2 |
| InChIKey | CPUVXUFJLIYTED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|