C17H11BrNO4- — CID 5178006
2-[2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 5178006) has the molecular formula C17H11BrNO4- and a molecular weight of 373.18 g/mol. Its IUPAC name is 2-[2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | 2-[2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 5178006 |
| Molecular Formula | C17H11BrNO4- |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-[2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)C(=Cc2ccccc2Br)Oc2ccccc21 |
| InChI | InChI=1S/C17H12BrNO4/c18-12-6-2-1-5-11(12)9-15-17(22)19(10-16(20)21)13-7-3-4-8-14(13)23-15/h1-9H,10H2,(H,20,21)/p-1 |
| InChIKey | RHRKXPKPLUSQAS-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|