C23H18BrN3O3 — CID 46373574
2-[(2E)-2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 46373574) has the molecular formula C23H18BrN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(2E)-2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46373574 |
| Molecular Formula | C23H18BrN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[(2E)-2-[(2-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2ccccc2Br)Oc2ccccc21)NCc1cccnc1 |
| InChI | InChI=1S/C23H18BrN3O3/c24-18-8-2-1-7-17(18)12-21-23(29)27(19-9-3-4-10-20(19)30-21)15-22(28)26-14-16-6-5-11-25-13-16/h1-13H,14-15H2,(H,26,28)/b21-12+ |
| InChIKey | AHYQEBRKQFCWPC-CIAFOILYSA-N |
| XLogP | 3.93 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|