C25H22N2O4 — CID 46250764
N-benzyl-2-[(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 46250764) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-benzyl-2-[(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-benzyl-2-[(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46250764 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-benzyl-2-[(2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | COc1cccc(/C=C2/Oc3ccccc3N(CC(=O)NCc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C25H22N2O4/c1-30-20-11-7-10-19(14-20)15-23-25(29)27(21-12-5-6-13-22(21)31-23)17-24(28)26-16-18-8-3-2-4-9-18/h2-15H,16-17H2,1H3,(H,26,28)/b23-15+ |
| InChIKey | MKHXWAQBGYKEEC-HZHRSRAPSA-N |
| XLogP | 3.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|