C27H26N2O3 — CID 4301073
2-(2-benzylidene-3-oxo-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 4301073) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(2-benzylidene-3-oxo-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(2-benzylidene-3-oxo-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 4301073 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(2-benzylidene-3-oxo-1,4-benzoxazin-4-yl)-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CN1C(=O)C(=Cc2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C27H26N2O3/c1-20(16-17-21-10-4-2-5-11-21)28-26(30)19-29-23-14-8-9-15-24(23)32-25(27(29)31)18-22-12-6-3-7-13-22/h2-15,18,20H,16-17,19H2,1H3,(H,28,30) |
| InChIKey | WSNYQKWVJJZUAJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|