C26H23ClN2O3 — CID 46250627
2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(4-methylphenyl)ethyl]acetamide (PubChem CID 46250627) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(4-methylphenyl)ethyl]acetamide.
| Compound Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(4-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46250627 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[(2E)-2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(4-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(CCNC(=O)CN2C(=O)/C(=C\c3cccc(Cl)c3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-18-9-11-19(12-10-18)13-14-28-25(30)17-29-22-7-2-3-8-23(22)32-24(26(29)31)16-20-5-4-6-21(27)15-20/h2-12,15-16H,13-14,17H2,1H3,(H,28,30)/b24-16+ |
| InChIKey | SVPPFULTRYUFMB-LFVJCYFKSA-N |
| XLogP | 4.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|