C29H29ClN2O5 — CID 4219123
2-[2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide (PubChem CID 4219123) has the molecular formula C29H29ClN2O5 and a molecular weight of 521.01 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4219123 |
| Molecular Formula | C29H29ClN2O5 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)CN2C(=O)C(=Cc3cccc(Cl)c3)Oc3ccccc32)cc1OCC |
| InChI | InChI=1S/C29H29ClN2O5/c1-3-35-25-13-12-20(17-26(25)36-4-2)14-15-31-28(33)19-32-23-10-5-6-11-24(23)37-27(29(32)34)18-21-8-7-9-22(30)16-21/h5-13,16-18H,3-4,14-15,19H2,1-2H3,(H,31,33) |
| InChIKey | WNHNAORSZNWRPR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|