C22H25ClN2O5 — CID 39067413
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide (PubChem CID 39067413) has the molecular formula C22H25ClN2O5 and a molecular weight of 432.90 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 39067413 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)CN2CC(=O)Oc3ccc(Cl)cc32)cc1OCC |
| InChI | InChI=1S/C22H25ClN2O5/c1-3-28-19-7-5-15(11-20(19)29-4-2)9-10-24-21(26)13-25-14-22(27)30-18-8-6-16(23)12-17(18)25/h5-8,11-12H,3-4,9-10,13-14H2,1-2H3,(H,24,26) |
| InChIKey | LEVFAMHYVYZDNN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|