C18H17ClN2O5 — CID 39059673
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 39059673) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39059673 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2CC(=O)Oc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C18H17ClN2O5/c1-24-12-4-6-15(25-2)13(8-12)20-17(22)9-21-10-18(23)26-16-5-3-11(19)7-14(16)21/h3-8H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | SGVKNVVQSHBLGU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|