C17H14N4O8 — CID 39060413
N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39060413) has the molecular formula C17H14N4O8 and a molecular weight of 402.32 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39060413 |
| Molecular Formula | C17H14N4O8 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CN1CC(=O)Oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H14N4O8/c1-28-14-5-3-10(20(24)25)6-12(14)18-16(22)8-19-9-17(23)29-15-7-11(21(26)27)2-4-13(15)19/h2-7H,8-9H2,1H3,(H,18,22) |
| InChIKey | RPQAQYQBCVVCAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|