C17H15N3O6 — CID 39060500
N-(2-methoxyphenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39060500) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39060500 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(2-methoxyphenyl)-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1CC(=O)Oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H15N3O6/c1-25-14-5-3-2-4-12(14)18-16(21)9-19-10-17(22)26-15-8-11(20(23)24)6-7-13(15)19/h2-8H,9-10H2,1H3,(H,18,21) |
| InChIKey | VDMQSRXEMGIDJR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|