C18H15N3O7 — CID 39060589
methyl 3-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate (PubChem CID 39060589) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is methyl 3-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39060589 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | methyl 3-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN2CC(=O)Oc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C18H15N3O7/c1-27-18(24)11-3-2-4-12(7-11)19-16(22)9-20-10-17(23)28-15-8-13(21(25)26)5-6-14(15)20/h2-8H,9-10H2,1H3,(H,19,22) |
| InChIKey | UPGQUFCYLOAOMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|