C18H14Cl2N2O5 — CID 39059735
methyl 4-chloro-3-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate (PubChem CID 39059735) has the molecular formula C18H14Cl2N2O5 and a molecular weight of 409.23 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39059735 |
| Molecular Formula | C18H14Cl2N2O5 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | methyl 4-chloro-3-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CN2CC(=O)Oc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C18H14Cl2N2O5/c1-26-18(25)10-2-4-12(20)13(6-10)21-16(23)8-22-9-17(24)27-15-5-3-11(19)7-14(15)22/h2-7H,8-9H2,1H3,(H,21,23) |
| InChIKey | OEUKPDOKRSJFJH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|