C23H26ClN3O5 — CID 39059626
2-(diethylamino)ethyl 4-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate (PubChem CID 39059626) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39059626 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CN2CC(=O)Oc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C23H26ClN3O5/c1-3-26(4-2)11-12-31-23(30)16-5-8-18(9-6-16)25-21(28)14-27-15-22(29)32-20-10-7-17(24)13-19(20)27/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,25,28) |
| InChIKey | MGSWQIRMLQMIBA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|