C17H13ClN2O6 — CID 39059719
5-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 39059719) has the molecular formula C17H13ClN2O6 and a molecular weight of 376.75 g/mol. Its IUPAC name is 5-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 39059719 |
| Molecular Formula | C17H13ClN2O6 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-[[2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(CN1CC(=O)Oc2ccc(Cl)cc21)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H13ClN2O6/c18-9-1-4-14-12(5-9)20(8-16(23)26-14)7-15(22)19-10-2-3-13(21)11(6-10)17(24)25/h1-6,21H,7-8H2,(H,19,22)(H,24,25) |
| InChIKey | XTLRNSDNEJMFIW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|