C18H15ClN2O5 — CID 39060055
2-chloro-5-[[2-(7-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid (PubChem CID 39060055) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-chloro-5-[[2-(7-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-chloro-5-[[2-(7-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 39060055 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-chloro-5-[[2-(7-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
| SMILES | Cc1ccc2c(c1)OC(=O)CN2CC(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H15ClN2O5/c1-10-2-5-14-15(6-10)26-17(23)9-21(14)8-16(22)20-11-3-4-13(19)12(7-11)18(24)25/h2-7H,8-9H2,1H3,(H,20,22)(H,24,25) |
| InChIKey | JHLOKMILSJXIQD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|