C18H16N2O6 — CID 39069910
2-hydroxy-4-[[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid (PubChem CID 39069910) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 39069910 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-hydroxy-4-[[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]benzoic acid |
| SMILES | Cc1ccc2c(c1)N(CC(=O)Nc1ccc(C(=O)O)c(O)c1)CC(=O)O2 |
| InChI | InChI=1S/C18H16N2O6/c1-10-2-5-15-13(6-10)20(9-17(23)26-15)8-16(22)19-11-3-4-12(18(24)25)14(21)7-11/h2-7,21H,8-9H2,1H3,(H,19,22)(H,24,25) |
| InChIKey | FNLCAPBNUZDGRT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|