C17H13Cl3N2O3 — CID 39059327
2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 39059327) has the molecular formula C17H13Cl3N2O3 and a molecular weight of 399.66 g/mol. Its IUPAC name is 2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 39059327 |
| Molecular Formula | C17H13Cl3N2O3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1ccc2c(c1)N(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)CC(=O)O2 |
| InChI | InChI=1S/C17H13Cl3N2O3/c1-9-2-3-15-14(4-9)22(8-17(24)25-15)7-16(23)21-13-6-11(19)10(18)5-12(13)20/h2-6H,7-8H2,1H3,(H,21,23) |
| InChIKey | ZDKVBXGFCIAYQL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|