C20H15Cl2N5O5S — CID 39059704
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 39059704) has the molecular formula C20H15Cl2N5O5S and a molecular weight of 508.34 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 39059704 |
| Molecular Formula | C20H15Cl2N5O5S |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccc(Cl)cc21)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O5S/c21-12-1-6-16-15(9-12)27(11-20(29)32-16)10-19(28)23-13-2-4-14(5-3-13)33(30,31)26-18-8-7-17(22)24-25-18/h1-9H,10-11H2,(H,23,28)(H,25,26) |
| InChIKey | ABTBZKVCZADVER-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|