C12H13ClN2O4 — CID 39067301
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 39067301) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 39067301 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(CN1CC(=O)Oc2ccc(Cl)cc21)NCCO |
| InChI | InChI=1S/C12H13ClN2O4/c13-8-1-2-10-9(5-8)15(7-12(18)19-10)6-11(17)14-3-4-16/h1-2,5,16H,3-4,6-7H2,(H,14,17) |
| InChIKey | QUYQYIDCGGWKKN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|