C13H15ClN2O4 — CID 39067403
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 39067403) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 39067403 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CC(=O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H15ClN2O4/c1-19-5-4-15-12(17)7-16-8-13(18)20-11-3-2-9(14)6-10(11)16/h2-3,6H,4-5,7-8H2,1H3,(H,15,17) |
| InChIKey | FUXZYDPVSMBKDQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|