C16H21ClN2O5 — CID 39069021
2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N,N-bis(2-methoxyethyl)acetamide (PubChem CID 39069021) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N,N-bis(2-methoxyethyl)acetamide.
| Compound Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N,N-bis(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 39069021 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-(6-chloro-2-oxo-3H-1,4-benzoxazin-4-yl)-N,N-bis(2-methoxyethyl)acetamide |
| SMILES | COCCN(CCOC)C(=O)CN1CC(=O)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H21ClN2O5/c1-22-7-5-18(6-8-23-2)15(20)10-19-11-16(21)24-14-4-3-12(17)9-13(14)19/h3-4,9H,5-8,10-11H2,1-2H3 |
| InChIKey | MWDFWHBAJRHSDU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|