C22H26N2O5 — CID 39061119
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide (PubChem CID 39061119) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39061119 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(2-oxo-3H-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CCOc1ccc(CCNC(=O)CN2CC(=O)Oc3ccccc32)cc1OCC |
| InChI | InChI=1S/C22H26N2O5/c1-3-27-19-10-9-16(13-20(19)28-4-2)11-12-23-21(25)14-24-15-22(26)29-18-8-6-5-7-17(18)24/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,23,25) |
| InChIKey | DURSZQPVTMJLAL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|