C30H32N2O6 — CID 6283845
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 6283845) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 6283845 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(2Z)-2-[(4-methoxyphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)CN2C(=O)/C(=C/c3ccc(OC)cc3)Oc3ccccc32)cc1OCC |
| InChI | InChI=1S/C30H32N2O6/c1-4-36-26-15-12-22(18-27(26)37-5-2)16-17-31-29(33)20-32-24-8-6-7-9-25(24)38-28(30(32)34)19-21-10-13-23(35-3)14-11-21/h6-15,18-19H,4-5,16-17,20H2,1-3H3,(H,31,33)/b28-19- |
| InChIKey | SXIRFXVBHTZFBU-USHMODERSA-N |
| XLogP | 4.62 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|