C27H25ClN2O5 — CID 4219267
2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 4219267) has the molecular formula C27H25ClN2O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4219267 |
| Molecular Formula | C27H25ClN2O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2C(=O)C(=Cc3ccccc3Cl)Oc3ccccc32)cc1OC |
| InChI | InChI=1S/C27H25ClN2O5/c1-33-23-12-11-18(15-24(23)34-2)13-14-29-26(31)17-30-21-9-5-6-10-22(21)35-25(27(30)32)16-19-7-3-4-8-20(19)28/h3-12,15-16H,13-14,17H2,1-2H3,(H,29,31) |
| InChIKey | XIVNBLMKDPAONL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|