C24H18ClFN2O3 — CID 4219270
2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 4219270) has the molecular formula C24H18ClFN2O3 and a molecular weight of 436.87 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 4219270 |
| Molecular Formula | C24H18ClFN2O3 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CN1C(=O)C(=Cc2ccccc2Cl)Oc2ccccc21)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H18ClFN2O3/c25-19-6-2-1-5-17(19)13-22-24(30)28(20-7-3-4-8-21(20)31-22)15-23(29)27-14-16-9-11-18(26)12-10-16/h1-13H,14-15H2,(H,27,29) |
| InChIKey | HJUCAWCNENXBAS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|